C48H81O11P — CID 156972920
[(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(Z)-icos-11-enoyl]oxypropyl] (5Z,7Z,10Z,13Z,16Z,19Z)-4-hydroxydocosa-5,7,10,13,16,19-hexaenoate (PubChem CID 156972920) has the molecular formula C48H81O11P and a molecular weight of 865.14 g/mol. Its IUPAC name is [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(Z)-icos-11-enoyl]oxypropyl] (5Z,7Z,10Z,13Z,16Z,19Z)-4-hydroxydocosa-5,7,10,13,16,19-hexaenoate.
| Compound Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(Z)-icos-11-enoyl]oxypropyl] (5Z,7Z,10Z,13Z,16Z,19Z)-4-hydroxydocosa-5,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 156972920 |
| Molecular Formula | C48H81O11P |
| Molecular Weight | 865.14 g/mol |
| Exact Mass | 864.55 |
| IUPAC Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(Z)-icos-11-enoyl]oxypropyl] (5Z,7Z,10Z,13Z,16Z,19Z)-4-hydroxydocosa-5,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C=C/C(O)CCC(=O)OC[C@H](COP(=O)(O)OC[C@@H](O)CO)OC(=O)CCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C48H81O11P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-48(53)59-46(43-58-60(54,55)57-41-45(51)40-49)42-56-47(52)39-38-44(50)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h6,8,12,14,17-20,24,26,30,32,34,36,44-46,49-51H,3-5,7,9-11,13,15-16,21-23,25,27-29,31,33,35,37-43H2,1-2H3,(H,54,55)/b8-6-,14-12-,19-17-,20-18-,26-24-,32-30-,36-34-/t44?,45-,46+/m0/s1 |
| InChIKey | PQICWNWQBLQEHK-NENMTLTNSA-N |
| XLogP | 11.19 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.14 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|