C24H25Cl2N3O — CID 15697379
2-(3,4-dichlorophenyl)-1-[1-(pyrrolidin-1-ylmethyl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]ethanone (PubChem CID 15697379) has the molecular formula C24H25Cl2N3O and a molecular weight of 442.39 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-[1-(pyrrolidin-1-ylmethyl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]ethanone.
| Compound Name | 2-(3,4-dichlorophenyl)-1-[1-(pyrrolidin-1-ylmethyl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]ethanone |
|---|---|
| PubChem CID | 15697379 |
| Molecular Formula | C24H25Cl2N3O |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-[1-(pyrrolidin-1-ylmethyl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]ethanone |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)N1CCc2[nH]c3ccccc3c2C1CN1CCCC1 |
| InChI | InChI=1S/C24H25Cl2N3O/c25-18-8-7-16(13-19(18)26)14-23(30)29-12-9-21-24(17-5-1-2-6-20(17)27-21)22(29)15-28-10-3-4-11-28/h1-2,5-8,13,22,27H,3-4,9-12,14-15H2 |
| InChIKey | SRBDHMOWSKFOIL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|