C38H65O13P — CID 156974472
[(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-(10-methylundecanoyloxy)propyl] (5S,6S,7Z,9Z,11E,13E,15R,17Z)-5,6,15-trihydroxyicosa-7,9,11,13,17-pentaenoate (PubChem CID 156974472) has the molecular formula C38H65O13P and a molecular weight of 760.90 g/mol. Its IUPAC name is [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-(10-methylundecanoyloxy)propyl] (5S,6S,7Z,9Z,11E,13E,15R,17Z)-5,6,15-trihydroxyicosa-7,9,11,13,17-pentaenoate.
| Compound Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-(10-methylundecanoyloxy)propyl] (5S,6S,7Z,9Z,11E,13E,15R,17Z)-5,6,15-trihydroxyicosa-7,9,11,13,17-pentaenoate |
|---|---|
| PubChem CID | 156974472 |
| Molecular Formula | C38H65O13P |
| Molecular Weight | 760.90 g/mol |
| Exact Mass | 760.42 |
| IUPAC Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-(10-methylundecanoyloxy)propyl] (5S,6S,7Z,9Z,11E,13E,15R,17Z)-5,6,15-trihydroxyicosa-7,9,11,13,17-pentaenoate |
| SMILES | CC/C=C\C[C@@H](O)/C=C/C=C/C=C\C=C/[C@H](O)[C@@H](O)CCCC(=O)OC[C@H](COP(=O)(O)OC[C@@H](O)CO)OC(=O)CCCCCCCCC(C)C |
| InChI | InChI=1S/C38H65O13P/c1-4-5-14-21-32(40)22-16-11-7-8-12-17-23-35(42)36(43)24-19-26-37(44)48-29-34(30-50-52(46,47)49-28-33(41)27-39)51-38(45)25-18-13-9-6-10-15-20-31(2)3/h5,7-8,11-12,14,16-17,22-23,31-36,39-43H,4,6,9-10,13,15,18-21,24-30H2,1-3H3,(H,46,47)/b11-7+,12-8-,14-5-,22-16+,23-17-/t32-,33+,34-,35+,36+/m1/s1 |
| InChIKey | AXVIEYRHGUWVBJ-RMABMBPOSA-N |
| XLogP | 5.54 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 52 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.90 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|