C36H65O11P — CID 156974490
[(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-(10-methylundecanoyloxy)propyl] (10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoate (PubChem CID 156974490) has the molecular formula C36H65O11P and a molecular weight of 704.88 g/mol. Its IUPAC name is [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-(10-methylundecanoyloxy)propyl] (10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoate.
| Compound Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-(10-methylundecanoyloxy)propyl] (10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoate |
|---|---|
| PubChem CID | 156974490 |
| Molecular Formula | C36H65O11P |
| Molecular Weight | 704.88 g/mol |
| Exact Mass | 704.43 |
| IUPAC Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-(10-methylundecanoyloxy)propyl] (10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoate |
| SMILES | CC/C=C/C/C=C/C=C/C(O)CCCCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@@H](O)CO)OC(=O)CCCCCCCCC(C)C |
| InChI | InChI=1S/C36H65O11P/c1-4-5-6-7-8-13-18-23-32(38)24-19-14-11-16-20-25-35(40)44-29-34(30-46-48(42,43)45-28-33(39)27-37)47-36(41)26-21-15-10-9-12-17-22-31(2)3/h5-6,8,13,18,23,31-34,37-39H,4,7,9-12,14-17,19-22,24-30H2,1-3H3,(H,42,43)/b6-5+,13-8+,23-18+/t32?,33-,34+/m0/s1 |
| InChIKey | MGCWLQBLVIYMEY-NCNYEFNJSA-N |
| XLogP | 7.27 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.88 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|