C42H76O14P2 — CID 156976219
[(2R)-3-[hydroxy-[(2S)-2-hydroxy-3-phosphonooxypropoxy]phosphoryl]oxy-2-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoyloxy]propyl] (9Z,11Z)-octadeca-9,11-dienoate (PubChem CID 156976219) has the molecular formula C42H76O14P2 and a molecular weight of 867.00 g/mol. Its IUPAC name is [(2R)-3-[hydroxy-[(2S)-2-hydroxy-3-phosphonooxypropoxy]phosphoryl]oxy-2-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoyloxy]propyl] (9Z,11Z)-octadeca-9,11-dienoate.
| Compound Name | [(2R)-3-[hydroxy-[(2S)-2-hydroxy-3-phosphonooxypropoxy]phosphoryl]oxy-2-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoyloxy]propyl] (9Z,11Z)-octadeca-9,11-dienoate |
|---|---|
| PubChem CID | 156976219 |
| Molecular Formula | C42H76O14P2 |
| Molecular Weight | 867.00 g/mol |
| Exact Mass | 866.47 |
| IUPAC Name | [(2R)-3-[hydroxy-[(2S)-2-hydroxy-3-phosphonooxypropoxy]phosphoryl]oxy-2-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoyloxy]propyl] (9Z,11Z)-octadeca-9,11-dienoate |
| SMILES | CCCCC/C=C\CC1OC1CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C\C=C/CCCCCC)COP(=O)(O)OC[C@@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C42H76O14P2/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-23-27-31-41(44)51-35-38(36-54-58(49,50)53-34-37(43)33-52-57(46,47)48)55-42(45)32-28-24-20-22-26-30-40-39(56-40)29-25-21-10-8-6-4-2/h12-15,21,25,37-40,43H,3-11,16-20,22-24,26-36H2,1-2H3,(H,49,50)(H2,46,47,48)/b13-12-,15-14-,25-21-/t37-,38+,39?,40?/m0/s1 |
| InChIKey | OQTLKFVNDYPRCF-ASFOIVSNSA-N |
| XLogP | 9.88 |
| TPSA | 207.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.00 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|