About 7-(2-bromophenyl)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one
7-(2-bromophenyl)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one (PubChem CID 15697626) has the molecular formula C13H9BrN2O
and a molecular weight of 289.13 g/mol. Its IUPAC name is 7-(2-bromophenyl)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one.
Molecular Properties
| Compound Name | 7-(2-bromophenyl)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one |
| PubChem CID | 15697626 |
| Molecular Formula | C13H9BrN2O |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 7-(2-bromophenyl)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one |
| SMILES | O=C1NC(c2ccccc2Br)c2ncccc21 |
| InChI | InChI=1S/C13H9BrN2O/c14-10-6-2-1-4-8(10)12-11-9(13(17)16-12)5-3-7-15-11/h1-7,12H,(H,16,17) |
| InChIKey | YKLKDTITUFYJJI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-(2-bromophenyl)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-bromophenyl)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one?
The IUPAC name of 7-(2-bromophenyl)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one (CID 15697626) is 7-(2-bromophenyl)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one.
What is the SMILES notation for 7-(2-bromophenyl)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one?
The canonical SMILES for 7-(2-bromophenyl)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one is O=C1NC(c2ccccc2Br)c2ncccc21.
What is the InChIKey of 7-(2-bromophenyl)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one?
The InChIKey is YKLKDTITUFYJJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrN2O/c14-10-6-2-1-4-8(10)12-11-9(13(17)16-12)5-3-7-15-11/h1-7,12H,(H,16,17).
What are the key properties of 7-(2-bromophenyl)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one?
7-(2-bromophenyl)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one has a molecular weight of 289.13 g/mol, XLogP of 2.68, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-bromophenyl)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one is sourced from PubChem (CID 15697626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).