About 7-(2-hydroxyethoxy)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one
7-(2-hydroxyethoxy)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one (PubChem CID 15697628) has the molecular formula C9H10N2O3
and a molecular weight of 194.19 g/mol. Its IUPAC name is 7-(2-hydroxyethoxy)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one.
Molecular Properties
| Compound Name | 7-(2-hydroxyethoxy)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one |
| PubChem CID | 15697628 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 7-(2-hydroxyethoxy)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one |
| SMILES | O=C1NC(OCCO)c2ncccc21 |
| InChI | InChI=1S/C9H10N2O3/c12-4-5-14-9-7-6(8(13)11-9)2-1-3-10-7/h1-3,9,12H,4-5H2,(H,11,13) |
| InChIKey | RXAUMBJICZKEGG-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(2-hydroxyethoxy)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-hydroxyethoxy)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one?
The IUPAC name of 7-(2-hydroxyethoxy)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one (CID 15697628) is 7-(2-hydroxyethoxy)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one.
What is the SMILES notation for 7-(2-hydroxyethoxy)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one?
The canonical SMILES for 7-(2-hydroxyethoxy)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one is O=C1NC(OCCO)c2ncccc21.
What is the InChIKey of 7-(2-hydroxyethoxy)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one?
The InChIKey is RXAUMBJICZKEGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O3/c12-4-5-14-9-7-6(8(13)11-9)2-1-3-10-7/h1-3,9,12H,4-5H2,(H,11,13).
What are the key properties of 7-(2-hydroxyethoxy)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one?
7-(2-hydroxyethoxy)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one has a molecular weight of 194.19 g/mol, XLogP of -0.17, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-hydroxyethoxy)-6,7-dihydropyrrolo[3,4-b]pyridin-5-one is sourced from PubChem (CID 15697628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).