C46H84O14P2 — CID 156976677
[(2R)-1-[hydroxy-[(2S)-2-hydroxy-3-phosphonooxypropoxy]phosphoryl]oxy-3-[(Z)-icos-11-enoyl]oxypropan-2-yl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate (PubChem CID 156976677) has the molecular formula C46H84O14P2 and a molecular weight of 923.11 g/mol. Its IUPAC name is [(2R)-1-[hydroxy-[(2S)-2-hydroxy-3-phosphonooxypropoxy]phosphoryl]oxy-3-[(Z)-icos-11-enoyl]oxypropan-2-yl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate.
| Compound Name | [(2R)-1-[hydroxy-[(2S)-2-hydroxy-3-phosphonooxypropoxy]phosphoryl]oxy-3-[(Z)-icos-11-enoyl]oxypropan-2-yl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate |
|---|---|
| PubChem CID | 156976677 |
| Molecular Formula | C46H84O14P2 |
| Molecular Weight | 923.11 g/mol |
| Exact Mass | 922.53 |
| IUPAC Name | [(2R)-1-[hydroxy-[(2S)-2-hydroxy-3-phosphonooxypropoxy]phosphoryl]oxy-3-[(Z)-icos-11-enoyl]oxypropan-2-yl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@@H](O)COP(=O)(O)O)OC(=O)CCCC(O)/C=C/C=C/C/C=C/CCCCCCCC |
| InChI | InChI=1S/C46H84O14P2/c1-3-5-7-9-11-13-15-17-18-19-20-22-24-26-28-30-32-36-45(49)56-40-44(41-59-62(54,55)58-39-43(48)38-57-61(51,52)53)60-46(50)37-33-35-42(47)34-31-29-27-25-23-21-16-14-12-10-8-6-4-2/h17-18,21,23,27,29,31,34,42-44,47-48H,3-16,19-20,22,24-26,28,30,32-33,35-41H2,1-2H3,(H,54,55)(H2,51,52,53)/b18-17-,23-21+,29-27+,34-31+/t42?,43-,44+/m0/s1 |
| InChIKey | DNNRKLAAXOHLRG-VRKSJQPCSA-N |
| XLogP | 11.20 |
| TPSA | 215.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.11 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|