C40H70NO12P — CID 156984296
(2S)-2-amino-3-[[(2R)-2-[(8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 156984296) has the molecular formula C40H70NO12P and a molecular weight of 787.97 g/mol. Its IUPAC name is (2S)-2-amino-3-[[(2R)-2-[(8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[[(2R)-2-[(8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 156984296 |
| Molecular Formula | C40H70NO12P |
| Molecular Weight | 787.97 g/mol |
| Exact Mass | 787.46 |
| IUPAC Name | (2S)-2-amino-3-[[(2R)-2-[(8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@H](N)C(=O)O)OC(=O)CCCC(O)C(O)C/C=C\C/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C40H70NO12P/c1-3-5-7-9-11-13-15-17-18-20-22-24-27-36(42)37(43)28-26-30-39(45)53-34(32-51-54(48,49)52-33-35(41)40(46)47)31-50-38(44)29-25-23-21-19-16-14-12-10-8-6-4-2/h10-13,17-18,22,24,34-37,42-43H,3-9,14-16,19-21,23,25-33,41H2,1-2H3,(H,46,47)(H,48,49)/b12-10-,13-11-,18-17-,24-22-/t34-,35+,36?,37?/m1/s1 |
| InChIKey | HTIMQNMAXKBEFZ-XZLWZQAASA-N |
| XLogP | 7.78 |
| TPSA | 212.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.97 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|