C44H76NO11P — CID 156984797
(2S)-2-amino-3-[hydroxy-[(2R)-3-[(5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoyl]oxy-2-[(Z)-octadec-11-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid (PubChem CID 156984797) has the molecular formula C44H76NO11P and a molecular weight of 826.06 g/mol. Its IUPAC name is (2S)-2-amino-3-[hydroxy-[(2R)-3-[(5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoyl]oxy-2-[(Z)-octadec-11-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[hydroxy-[(2R)-3-[(5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoyl]oxy-2-[(Z)-octadec-11-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 156984797 |
| Molecular Formula | C44H76NO11P |
| Molecular Weight | 826.06 g/mol |
| Exact Mass | 825.52 |
| IUPAC Name | (2S)-2-amino-3-[hydroxy-[(2R)-3-[(5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoyl]oxy-2-[(Z)-octadec-11-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid |
| SMILES | CCCCC/C=C\C/C=C\CC(O)/C=C\C=C\CCCC(=O)OC[C@H](COP(=O)(O)OC[C@H](N)C(=O)O)OC(=O)CCCCCCCCC/C=C\CCCCCC |
| InChI | InChI=1S/C44H76NO11P/c1-3-5-7-9-11-13-14-15-16-17-18-20-22-26-31-35-43(48)56-40(37-54-57(51,52)55-38-41(45)44(49)50)36-53-42(47)34-30-27-23-25-29-33-39(46)32-28-24-21-19-12-10-8-6-4-2/h12-14,19,23-25,28-29,33,39-41,46H,3-11,15-18,20-22,26-27,30-32,34-38,45H2,1-2H3,(H,49,50)(H,51,52)/b14-13-,19-12-,25-23+,28-24-,33-29-/t39?,40-,41+/m1/s1 |
| InChIKey | PNYKTLHSUISESI-HQDSHQMSSA-N |
| XLogP | 10.14 |
| TPSA | 191.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.06 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|