C42H74NO11P — CID 156984863
(2S)-2-amino-3-[hydroxy-[(2R)-3-[(10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoyl]oxy-2-[(Z)-octadec-11-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid (PubChem CID 156984863) has the molecular formula C42H74NO11P and a molecular weight of 800.02 g/mol. Its IUPAC name is (2S)-2-amino-3-[hydroxy-[(2R)-3-[(10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoyl]oxy-2-[(Z)-octadec-11-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[hydroxy-[(2R)-3-[(10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoyl]oxy-2-[(Z)-octadec-11-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 156984863 |
| Molecular Formula | C42H74NO11P |
| Molecular Weight | 800.02 g/mol |
| Exact Mass | 799.50 |
| IUPAC Name | (2S)-2-amino-3-[hydroxy-[(2R)-3-[(10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoyl]oxy-2-[(Z)-octadec-11-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid |
| SMILES | CC/C=C/C/C=C/C=C/C(O)CCCCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@H](N)C(=O)O)OC(=O)CCCCCCCCC/C=C\CCCCCC |
| InChI | InChI=1S/C42H74NO11P/c1-3-5-7-9-11-12-13-14-15-16-17-18-20-24-29-33-41(46)54-38(35-52-55(49,50)53-36-39(43)42(47)48)34-51-40(45)32-28-25-21-23-27-31-37(44)30-26-22-19-10-8-6-4-2/h6,8,12-13,19,22,26,30,37-39,44H,3-5,7,9-11,14-18,20-21,23-25,27-29,31-36,43H2,1-2H3,(H,47,48)(H,49,50)/b8-6+,13-12-,22-19+,30-26+/t37?,38-,39+/m1/s1 |
| InChIKey | GEPOLSYCCBFVDC-IDUOSURJSA-N |
| XLogP | 9.58 |
| TPSA | 191.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.02 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|