About 4-amino-1-(2,4-dichlorophenyl)-5-methylpyrazolo[3,4-d]pyrimidin-6-one
4-amino-1-(2,4-dichlorophenyl)-5-methylpyrazolo[3,4-d]pyrimidin-6-one (PubChem CID 15698864) has the molecular formula C12H9Cl2N5O
and a molecular weight of 310.14 g/mol. Its IUPAC name is 4-amino-1-(2,4-dichlorophenyl)-5-methylpyrazolo[3,4-d]pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-amino-1-(2,4-dichlorophenyl)-5-methylpyrazolo[3,4-d]pyrimidin-6-one |
| PubChem CID | 15698864 |
| Molecular Formula | C12H9Cl2N5O |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 4-amino-1-(2,4-dichlorophenyl)-5-methylpyrazolo[3,4-d]pyrimidin-6-one |
| SMILES | Cn1c(N)c2cnn(-c3ccc(Cl)cc3Cl)c2nc1=O |
| InChI | InChI=1S/C12H9Cl2N5O/c1-18-10(15)7-5-16-19(11(7)17-12(18)20)9-3-2-6(13)4-8(9)14/h2-5H,15H2,1H3 |
| InChIKey | HEFNNANYHBYJAI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-amino-1-(2,4-dichlorophenyl)-5-methylpyrazolo[3,4-d]pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-(2,4-dichlorophenyl)-5-methylpyrazolo[3,4-d]pyrimidin-6-one?
The IUPAC name of 4-amino-1-(2,4-dichlorophenyl)-5-methylpyrazolo[3,4-d]pyrimidin-6-one (CID 15698864) is 4-amino-1-(2,4-dichlorophenyl)-5-methylpyrazolo[3,4-d]pyrimidin-6-one.
What is the SMILES notation for 4-amino-1-(2,4-dichlorophenyl)-5-methylpyrazolo[3,4-d]pyrimidin-6-one?
The canonical SMILES for 4-amino-1-(2,4-dichlorophenyl)-5-methylpyrazolo[3,4-d]pyrimidin-6-one is Cn1c(N)c2cnn(-c3ccc(Cl)cc3Cl)c2nc1=O.
What is the InChIKey of 4-amino-1-(2,4-dichlorophenyl)-5-methylpyrazolo[3,4-d]pyrimidin-6-one?
The InChIKey is HEFNNANYHBYJAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Cl2N5O/c1-18-10(15)7-5-16-19(11(7)17-12(18)20)9-3-2-6(13)4-8(9)14/h2-5H,15H2,1H3.
What are the key properties of 4-amino-1-(2,4-dichlorophenyl)-5-methylpyrazolo[3,4-d]pyrimidin-6-one?
4-amino-1-(2,4-dichlorophenyl)-5-methylpyrazolo[3,4-d]pyrimidin-6-one has a molecular weight of 310.14 g/mol, XLogP of 2.01, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-(2,4-dichlorophenyl)-5-methylpyrazolo[3,4-d]pyrimidin-6-one is sourced from PubChem (CID 15698864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).