C46H85NO9P+ — CID 156992159
2-[hydroxy-[(2R)-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxy-3-[(Z)-11-(3-pentyloxiran-2-yl)undec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 156992159) has the molecular formula C46H85NO9P+ and a molecular weight of 827.16 g/mol. Its IUPAC name is 2-[hydroxy-[(2R)-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxy-3-[(Z)-11-(3-pentyloxiran-2-yl)undec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[(2R)-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxy-3-[(Z)-11-(3-pentyloxiran-2-yl)undec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 156992159 |
| Molecular Formula | C46H85NO9P+ |
| Molecular Weight | 827.16 g/mol |
| Exact Mass | 826.60 |
| IUPAC Name | 2-[hydroxy-[(2R)-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxy-3-[(Z)-11-(3-pentyloxiran-2-yl)undec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C\CC1OC1CCCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C46H84NO9P/c1-6-8-10-11-12-13-14-15-16-17-18-19-20-21-26-29-33-37-46(49)55-42(41-54-57(50,51)53-39-38-47(3,4)5)40-52-45(48)36-32-28-25-23-22-24-27-31-35-44-43(56-44)34-30-9-7-2/h12-13,15-16,27,31,42-44H,6-11,14,17-26,28-30,32-41H2,1-5H3/p+1/b13-12-,16-15-,31-27-/t42-,43?,44?/m1/s1 |
| InChIKey | WDDJXUDSJNOSDO-ZVMJZYKISA-O |
| XLogP | 11.90 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.16 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|