C48H87NO9P+ — CID 156992239
2-[hydroxy-[(2R)-3-[(6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoyl]oxy-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 156992239) has the molecular formula C48H87NO9P+ and a molecular weight of 853.20 g/mol. Its IUPAC name is 2-[hydroxy-[(2R)-3-[(6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoyl]oxy-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[(2R)-3-[(6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoyl]oxy-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 156992239 |
| Molecular Formula | C48H87NO9P+ |
| Molecular Weight | 853.20 g/mol |
| Exact Mass | 852.61 |
| IUPAC Name | 2-[hydroxy-[(2R)-3-[(6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoyl]oxy-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)O[C@H](COC(=O)CCCC(O)/C=C/C=C/C/C=C/CCCCCCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C48H86NO9P/c1-6-8-10-12-14-16-18-20-21-22-23-25-27-29-31-33-35-39-48(52)58-46(44-57-59(53,54)56-42-41-49(3,4)5)43-55-47(51)40-36-38-45(50)37-34-32-30-28-26-24-19-17-15-13-11-9-7-2/h14,16,20-21,24,26,30,32,34,37,45-46,50H,6-13,15,17-19,22-23,25,27-29,31,33,35-36,38-44H2,1-5H3/p+1/b16-14-,21-20-,26-24+,32-30+,37-34+/t45?,46-/m1/s1 |
| InChIKey | MEMMRMVMEWWHBC-MGVMXJJVSA-O |
| XLogP | 12.22 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.20 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|