C16H20O3 — CID 15699298
methyl 2-[(2R,8R,8aR)-8,8a-dimethyl-7-oxo-1,2,3,8-tetrahydronaphthalen-2-yl]prop-2-enoate (PubChem CID 15699298) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is methyl 2-[(2R,8R,8aR)-8,8a-dimethyl-7-oxo-1,2,3,8-tetrahydronaphthalen-2-yl]prop-2-enoate.
| Compound Name | methyl 2-[(2R,8R,8aR)-8,8a-dimethyl-7-oxo-1,2,3,8-tetrahydronaphthalen-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 15699298 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | methyl 2-[(2R,8R,8aR)-8,8a-dimethyl-7-oxo-1,2,3,8-tetrahydronaphthalen-2-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1CC=C2C=CC(=O)[C@H](C)[C@@]2(C)C1 |
| InChI | InChI=1S/C16H20O3/c1-10(15(18)19-4)12-5-6-13-7-8-14(17)11(2)16(13,3)9-12/h6-8,11-12H,1,5,9H2,2-4H3/t11-,12+,16+/m0/s1 |
| InChIKey | JGZDPLNVUOFETD-HWWQOWPSSA-N |
| XLogP | 2.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|