C17H22O5 — CID 15699312
2-[(1R,3E,5S)-5-acetyloxy-4-methyl-8-methylidene-7-oxocyclodec-3-en-1-yl]prop-2-enoic acid (PubChem CID 15699312) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-[(1R,3E,5S)-5-acetyloxy-4-methyl-8-methylidene-7-oxocyclodec-3-en-1-yl]prop-2-enoic acid.
| Compound Name | 2-[(1R,3E,5S)-5-acetyloxy-4-methyl-8-methylidene-7-oxocyclodec-3-en-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 15699312 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2-[(1R,3E,5S)-5-acetyloxy-4-methyl-8-methylidene-7-oxocyclodec-3-en-1-yl]prop-2-enoic acid |
| SMILES | C=C1CC[C@@H](C(=C)C(=O)O)C/C=C(\C)[C@@H](OC(C)=O)CC1=O |
| InChI | InChI=1S/C17H22O5/c1-10-5-7-14(12(3)17(20)21)8-6-11(2)16(9-15(10)19)22-13(4)18/h6,14,16H,1,3,5,7-9H2,2,4H3,(H,20,21)/b11-6+/t14-,16+/m1/s1 |
| InChIKey | MVYLZGKQJCLZFA-GCYODBRDSA-N |
| XLogP | 2.82 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|