About methyl 4-[(1S,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enoate
methyl 4-[(1S,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enoate (PubChem CID 15699320) has the molecular formula C16H26O3
and a molecular weight of 266.38 g/mol. Its IUPAC name is methyl 4-[(1S,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enoate.
Molecular Properties
| Compound Name | methyl 4-[(1S,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enoate |
| PubChem CID | 15699320 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | methyl 4-[(1S,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enoate |
| SMILES | C=C(CCC(=O)OC)[C@H]1CC(C)(C)[C@@H]1CCC(C)=O |
| InChI | InChI=1S/C16H26O3/c1-11(6-9-15(18)19-5)13-10-16(3,4)14(13)8-7-12(2)17/h13-14H,1,6-10H2,2-5H3/t13-,14-/m1/s1 |
| InChIKey | YYOBSKGBCIIJSK-ZIAGYGMSSA-N |
| XLogP | 3.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[(1S,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(1S,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enoate?
The IUPAC name of methyl 4-[(1S,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enoate (CID 15699320) is methyl 4-[(1S,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enoate.
What is the SMILES notation for methyl 4-[(1S,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enoate?
The canonical SMILES for methyl 4-[(1S,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enoate is C=C(CCC(=O)OC)[C@H]1CC(C)(C)[C@@H]1CCC(C)=O.
What is the InChIKey of methyl 4-[(1S,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enoate?
The InChIKey is YYOBSKGBCIIJSK-ZIAGYGMSSA-N. The full InChI is InChI=1S/C16H26O3/c1-11(6-9-15(18)19-5)13-10-16(3,4)14(13)8-7-12(2)17/h13-14H,1,6-10H2,2-5H3/t13-,14-/m1/s1.
What are the key properties of methyl 4-[(1S,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enoate?
methyl 4-[(1S,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enoate has a molecular weight of 266.38 g/mol, XLogP of 3.53, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(1S,2R)-3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enoate is sourced from PubChem (CID 15699320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).