C30H54NO11P — CID 156995548
[(2R)-3-acetyloxy-2-[7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156995548) has the molecular formula C30H54NO11P and a molecular weight of 635.73 g/mol. Its IUPAC name is [(2R)-3-acetyloxy-2-[7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-acetyloxy-2-[7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156995548 |
| Molecular Formula | C30H54NO11P |
| Molecular Weight | 635.73 g/mol |
| Exact Mass | 635.34 |
| IUPAC Name | [(2R)-3-acetyloxy-2-[7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)O[C@H](COC(C)=O)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C30H54NO11P/c1-6-7-10-13-24(33)16-17-27-26(28(34)20-29(27)35)14-11-8-9-12-15-30(36)42-25(21-39-23(2)32)22-41-43(37,38)40-19-18-31(3,4)5/h16-17,24-27,29,33,35H,6-15,18-22H2,1-5H3/b17-16+/t24-,25+,26+,27+,29+/m0/s1 |
| InChIKey | CTVXUMCEKKIZJE-GTUFVOORSA-N |
| XLogP | 3.07 |
| TPSA | 168.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.73 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|