About 3-hydroxy-6-(hydroxymethyl)-2-octa-1,7-dien-3-ylpyran-4-one
3-hydroxy-6-(hydroxymethyl)-2-octa-1,7-dien-3-ylpyran-4-one (PubChem CID 15699630) has the molecular formula C14H18O4
and a molecular weight of 250.29 g/mol. Its IUPAC name is 3-hydroxy-6-(hydroxymethyl)-2-octa-1,7-dien-3-ylpyran-4-one.
Molecular Properties
| Compound Name | 3-hydroxy-6-(hydroxymethyl)-2-octa-1,7-dien-3-ylpyran-4-one |
| PubChem CID | 15699630 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 3-hydroxy-6-(hydroxymethyl)-2-octa-1,7-dien-3-ylpyran-4-one |
| SMILES | C=CCCCC(C=C)c1oc(CO)cc(=O)c1O |
| InChI | InChI=1S/C14H18O4/c1-3-5-6-7-10(4-2)14-13(17)12(16)8-11(9-15)18-14/h3-4,8,10,15,17H,1-2,5-7,9H2 |
| InChIKey | NTHDWOMHTZNDBG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-6-(hydroxymethyl)-2-octa-1,7-dien-3-ylpyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-6-(hydroxymethyl)-2-octa-1,7-dien-3-ylpyran-4-one?
The IUPAC name of 3-hydroxy-6-(hydroxymethyl)-2-octa-1,7-dien-3-ylpyran-4-one (CID 15699630) is 3-hydroxy-6-(hydroxymethyl)-2-octa-1,7-dien-3-ylpyran-4-one.
What is the SMILES notation for 3-hydroxy-6-(hydroxymethyl)-2-octa-1,7-dien-3-ylpyran-4-one?
The canonical SMILES for 3-hydroxy-6-(hydroxymethyl)-2-octa-1,7-dien-3-ylpyran-4-one is C=CCCCC(C=C)c1oc(CO)cc(=O)c1O.
What is the InChIKey of 3-hydroxy-6-(hydroxymethyl)-2-octa-1,7-dien-3-ylpyran-4-one?
The InChIKey is NTHDWOMHTZNDBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O4/c1-3-5-6-7-10(4-2)14-13(17)12(16)8-11(9-15)18-14/h3-4,8,10,15,17H,1-2,5-7,9H2.
What are the key properties of 3-hydroxy-6-(hydroxymethyl)-2-octa-1,7-dien-3-ylpyran-4-one?
3-hydroxy-6-(hydroxymethyl)-2-octa-1,7-dien-3-ylpyran-4-one has a molecular weight of 250.29 g/mol, XLogP of 2.46, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-6-(hydroxymethyl)-2-octa-1,7-dien-3-ylpyran-4-one is sourced from PubChem (CID 15699630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).