C16H26O3Si — CID 15699670
(6S)-7-methyl-6-(2-trimethylsilylethoxymethoxy)-1,4,5,6-tetrahydroinden-2-one (PubChem CID 15699670) has the molecular formula C16H26O3Si and a molecular weight of 294.47 g/mol. Its IUPAC name is (6S)-7-methyl-6-(2-trimethylsilylethoxymethoxy)-1,4,5,6-tetrahydroinden-2-one.
| Compound Name | (6S)-7-methyl-6-(2-trimethylsilylethoxymethoxy)-1,4,5,6-tetrahydroinden-2-one |
|---|---|
| PubChem CID | 15699670 |
| Molecular Formula | C16H26O3Si |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (6S)-7-methyl-6-(2-trimethylsilylethoxymethoxy)-1,4,5,6-tetrahydroinden-2-one |
| SMILES | CC1=C2CC(=O)C=C2CC[C@@H]1OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C16H26O3Si/c1-12-15-10-14(17)9-13(15)5-6-16(12)19-11-18-7-8-20(2,3)4/h9,16H,5-8,10-11H2,1-4H3/t16-/m0/s1 |
| InChIKey | DRGJFCVWXPGKHD-INIZCTEOSA-N |
| XLogP | 3.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|