C46H82NO8P — CID 156997056
[(2R)-3-[(5Z,8Z,11Z,14Z,16S)-16-hydroxyicosa-5,8,11,14-tetraenoyl]oxy-2-[(1E,11Z)-octadeca-1,11-dienoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156997056) has the molecular formula C46H82NO8P and a molecular weight of 808.13 g/mol. Its IUPAC name is [(2R)-3-[(5Z,8Z,11Z,14Z,16S)-16-hydroxyicosa-5,8,11,14-tetraenoyl]oxy-2-[(1E,11Z)-octadeca-1,11-dienoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-[(5Z,8Z,11Z,14Z,16S)-16-hydroxyicosa-5,8,11,14-tetraenoyl]oxy-2-[(1E,11Z)-octadeca-1,11-dienoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156997056 |
| Molecular Formula | C46H82NO8P |
| Molecular Weight | 808.13 g/mol |
| Exact Mass | 807.58 |
| IUPAC Name | [(2R)-3-[(5Z,8Z,11Z,14Z,16S)-16-hydroxyicosa-5,8,11,14-tetraenoyl]oxy-2-[(1E,11Z)-octadeca-1,11-dienoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCC/C=C\CCCCCCCC/C=C/O[C@H](COC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\[C@@H](O)CCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C46H82NO8P/c1-6-8-10-11-12-13-14-15-16-17-20-23-26-29-32-35-40-52-45(43-55-56(50,51)54-41-39-47(3,4)5)42-53-46(49)38-34-31-28-25-22-19-18-21-24-27-30-33-37-44(48)36-9-7-2/h13-14,18-19,24-25,27-28,33,35,37,40,44-45,48H,6-12,15-17,20-23,26,29-32,34,36,38-39,41-43H2,1-5H3/b14-13-,19-18-,27-24-,28-25-,37-33-,40-35+/t44-,45+/m0/s1 |
| InChIKey | KFVBCADPJBOXNG-QETYCBJXSA-N |
| XLogP | 11.40 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.13 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|