C44H85NO9P+ — CID 156997343
2-[[(2R)-2-[(Z,9S,10S)-9,10-dihydroxyoctadec-12-enoyl]oxy-3-[(1E,9Z)-octadeca-1,9-dienoxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 156997343) has the molecular formula C44H85NO9P+ and a molecular weight of 803.14 g/mol. Its IUPAC name is 2-[[(2R)-2-[(Z,9S,10S)-9,10-dihydroxyoctadec-12-enoyl]oxy-3-[(1E,9Z)-octadeca-1,9-dienoxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R)-2-[(Z,9S,10S)-9,10-dihydroxyoctadec-12-enoyl]oxy-3-[(1E,9Z)-octadeca-1,9-dienoxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 156997343 |
| Molecular Formula | C44H85NO9P+ |
| Molecular Weight | 803.14 g/mol |
| Exact Mass | 802.60 |
| IUPAC Name | 2-[[(2R)-2-[(Z,9S,10S)-9,10-dihydroxyoctadec-12-enoyl]oxy-3-[(1E,9Z)-octadeca-1,9-dienoxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCC/C=C\C[C@H](O)[C@@H](O)CCCCCCCC(=O)O[C@H](CO/C=C/CCCCCC/C=C\CCCCCCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C44H84NO9P/c1-6-8-10-12-14-15-16-17-18-19-20-21-22-23-28-32-37-51-39-41(40-53-55(49,50)52-38-36-45(3,4)5)54-44(48)35-31-27-24-26-30-34-43(47)42(46)33-29-25-13-11-9-7-2/h17-18,25,29,32,37,41-43,46-47H,6-16,19-24,26-28,30-31,33-36,38-40H2,1-5H3/p+1/b18-17-,29-25-,37-32+/t41-,42+,43+/m1/s1 |
| InChIKey | ZLVDUYKIQHEZPO-GQTFWXDWSA-O |
| XLogP | 10.89 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.14 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|