C39H74N2O7P+ — CID 156997994
2-[hydroxy-[(2S,3R,4E,8Z)-3-hydroxy-2-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoylamino]hexadeca-4,8-dienoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 156997994) has the molecular formula C39H74N2O7P+ and a molecular weight of 714.00 g/mol. Its IUPAC name is 2-[hydroxy-[(2S,3R,4E,8Z)-3-hydroxy-2-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoylamino]hexadeca-4,8-dienoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[(2S,3R,4E,8Z)-3-hydroxy-2-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoylamino]hexadeca-4,8-dienoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 156997994 |
| Molecular Formula | C39H74N2O7P+ |
| Molecular Weight | 714.00 g/mol |
| Exact Mass | 713.52 |
| IUPAC Name | 2-[hydroxy-[(2S,3R,4E,8Z)-3-hydroxy-2-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoylamino]hexadeca-4,8-dienoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCC/C=C\CC1OC1CCCCCCCC(=O)N[C@@H](COP(=O)(O)OCC[N+](C)(C)C)[C@H](O)/C=C/CC/C=C\CCCCCCC |
| InChI | InChI=1S/C39H73N2O7P/c1-6-8-10-12-14-15-16-17-18-20-24-28-36(42)35(34-47-49(44,45)46-33-32-41(3,4)5)40-39(43)31-27-23-19-22-26-30-38-37(48-38)29-25-21-13-11-9-7-2/h16-17,21,24-25,28,35-38,42H,6-15,18-20,22-23,26-27,29-34H2,1-5H3,(H-,40,43,44,45)/p+1/b17-16-,25-21-,28-24+/t35-,36+,37?,38?/m0/s1 |
| InChIKey | FANSYDQJXUKWCS-BUCAXOMUSA-O |
| XLogP | 8.95 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.00 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|