C34H46O2S2Si — CID 15700105
tert-butyl-[(2R,5S)-6-(1,3-dithian-2-yl)-2-methyl-5-phenylmethoxyhexoxy]-diphenylsilane (PubChem CID 15700105) has the molecular formula C34H46O2S2Si and a molecular weight of 578.96 g/mol. Its IUPAC name is tert-butyl-[(2R,5S)-6-(1,3-dithian-2-yl)-2-methyl-5-phenylmethoxyhexoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2R,5S)-6-(1,3-dithian-2-yl)-2-methyl-5-phenylmethoxyhexoxy]-diphenylsilane |
|---|---|
| PubChem CID | 15700105 |
| Molecular Formula | C34H46O2S2Si |
| Molecular Weight | 578.96 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | tert-butyl-[(2R,5S)-6-(1,3-dithian-2-yl)-2-methyl-5-phenylmethoxyhexoxy]-diphenylsilane |
| SMILES | C[C@H](CC[C@@H](CC1SCCCS1)OCc1ccccc1)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H46O2S2Si/c1-28(21-22-30(25-33-37-23-14-24-38-33)35-27-29-15-8-5-9-16-29)26-36-39(34(2,3)4,31-17-10-6-11-18-31)32-19-12-7-13-20-32/h5-13,15-20,28,30,33H,14,21-27H2,1-4H3/t28-,30+/m1/s1 |
| InChIKey | RFZJLFSEVWVTBE-DGPALRBDSA-N |
| XLogP | 8.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.96 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|