C36H61NO8S — CID 157002581
(5S,6R,7E,9E,11Z,14Z)-6-[(2R)-2-amino-3-[(2S)-2-decanoyloxy-3-hydroxypropoxy]-3-oxopropyl]sulfanyl-5-hydroxyicosa-7,9,11,14-tetraenoic acid (PubChem CID 157002581) has the molecular formula C36H61NO8S and a molecular weight of 667.95 g/mol. Its IUPAC name is (5S,6R,7E,9E,11Z,14Z)-6-[(2R)-2-amino-3-[(2S)-2-decanoyloxy-3-hydroxypropoxy]-3-oxopropyl]sulfanyl-5-hydroxyicosa-7,9,11,14-tetraenoic acid.
| Compound Name | (5S,6R,7E,9E,11Z,14Z)-6-[(2R)-2-amino-3-[(2S)-2-decanoyloxy-3-hydroxypropoxy]-3-oxopropyl]sulfanyl-5-hydroxyicosa-7,9,11,14-tetraenoic acid |
|---|---|
| PubChem CID | 157002581 |
| Molecular Formula | C36H61NO8S |
| Molecular Weight | 667.95 g/mol |
| Exact Mass | 667.41 |
| IUPAC Name | (5S,6R,7E,9E,11Z,14Z)-6-[(2R)-2-amino-3-[(2S)-2-decanoyloxy-3-hydroxypropoxy]-3-oxopropyl]sulfanyl-5-hydroxyicosa-7,9,11,14-tetraenoic acid |
| SMILES | CCCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](N)C(=O)OC[C@H](CO)OC(=O)CCCCCCCCC)[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C36H61NO8S/c1-3-5-7-9-11-12-13-14-15-17-18-20-24-33(32(39)23-22-25-34(40)41)46-29-31(37)36(43)44-28-30(27-38)45-35(42)26-21-19-16-10-8-6-4-2/h11-12,14-15,17-18,20,24,30-33,38-39H,3-10,13,16,19,21-23,25-29,37H2,1-2H3,(H,40,41)/b12-11-,15-14-,18-17+,24-20+/t30-,31-,32-,33+/m0/s1 |
| InChIKey | PDYORNIOHWFLAP-XXXOFKRQSA-N |
| XLogP | 6.81 |
| TPSA | 156.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.95 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|