C33H58O9 — CID 157002590
[(2R)-3-[(Z)-7-[(2R,3S,4S)-4,6-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]oxan-3-yl]hept-5-enoyl]oxy-2-hydroxypropyl] decanoate (PubChem CID 157002590) has the molecular formula C33H58O9 and a molecular weight of 598.82 g/mol. Its IUPAC name is [(2R)-3-[(Z)-7-[(2R,3S,4S)-4,6-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]oxan-3-yl]hept-5-enoyl]oxy-2-hydroxypropyl] decanoate.
| Compound Name | [(2R)-3-[(Z)-7-[(2R,3S,4S)-4,6-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]oxan-3-yl]hept-5-enoyl]oxy-2-hydroxypropyl] decanoate |
|---|---|
| PubChem CID | 157002590 |
| Molecular Formula | C33H58O9 |
| Molecular Weight | 598.82 g/mol |
| Exact Mass | 598.41 |
| IUPAC Name | [(2R)-3-[(Z)-7-[(2R,3S,4S)-4,6-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]oxan-3-yl]hept-5-enoyl]oxy-2-hydroxypropyl] decanoate |
| SMILES | CCCCCCCCCC(=O)OC[C@@H](O)COC(=O)CCC/C=C\C[C@H]1[C@@H](O)CC(O)O[C@@H]1/C=C/[C@@H](O)CCCCC |
| InChI | InChI=1S/C33H58O9/c1-3-5-7-8-9-10-15-19-31(37)40-24-27(35)25-41-32(38)20-16-12-11-14-18-28-29(36)23-33(39)42-30(28)22-21-26(34)17-13-6-4-2/h11,14,21-22,26-30,33-36,39H,3-10,12-13,15-20,23-25H2,1-2H3/b14-11-,22-21+/t26-,27+,28-,29-,30+,33?/m0/s1 |
| InChIKey | PARFEDOXMKOIGA-CVOZYXSZSA-N |
| XLogP | 5.27 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.82 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|