C31H52O7 — CID 157005317
[(2S)-2-hydroxy-3-octanoyloxypropyl] (5R,6E,8Z,11Z,13E,15S)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate (PubChem CID 157005317) has the molecular formula C31H52O7 and a molecular weight of 536.75 g/mol. Its IUPAC name is [(2S)-2-hydroxy-3-octanoyloxypropyl] (5R,6E,8Z,11Z,13E,15S)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate.
| Compound Name | [(2S)-2-hydroxy-3-octanoyloxypropyl] (5R,6E,8Z,11Z,13E,15S)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate |
|---|---|
| PubChem CID | 157005317 |
| Molecular Formula | C31H52O7 |
| Molecular Weight | 536.75 g/mol |
| Exact Mass | 536.37 |
| IUPAC Name | [(2S)-2-hydroxy-3-octanoyloxypropyl] (5R,6E,8Z,11Z,13E,15S)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate |
| SMILES | CCCCCCCC(=O)OC[C@H](O)COC(=O)CCC[C@@H](O)/C=C/C=C\C/C=C\C=C\[C@@H](O)CCCCC |
| InChI | InChI=1S/C31H52O7/c1-3-5-7-11-17-23-30(35)37-25-29(34)26-38-31(36)24-18-22-28(33)21-16-13-10-8-9-12-15-20-27(32)19-14-6-4-2/h9-10,12-13,15-16,20-21,27-29,32-34H,3-8,11,14,17-19,22-26H2,1-2H3/b12-9-,13-10-,20-15+,21-16+/t27-,28-,29-/m0/s1 |
| InChIKey | CLQYPPJHUBSSBB-FLJTXDRDSA-N |
| XLogP | 5.88 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.75 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|