C36H64O9 — CID 157006683
[(2S)-3-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-6-oxoheptanoyl]oxy-2-hydroxypropyl] 11-methyldodecanoate (PubChem CID 157006683) has the molecular formula C36H64O9 and a molecular weight of 640.90 g/mol. Its IUPAC name is [(2S)-3-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-6-oxoheptanoyl]oxy-2-hydroxypropyl] 11-methyldodecanoate.
| Compound Name | [(2S)-3-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-6-oxoheptanoyl]oxy-2-hydroxypropyl] 11-methyldodecanoate |
|---|---|
| PubChem CID | 157006683 |
| Molecular Formula | C36H64O9 |
| Molecular Weight | 640.90 g/mol |
| Exact Mass | 640.46 |
| IUPAC Name | [(2S)-3-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-6-oxoheptanoyl]oxy-2-hydroxypropyl] 11-methyldodecanoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](CC(=O)CCCCC(=O)OC[C@@H](O)COC(=O)CCCCCCCCCC(C)C)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C36H64O9/c1-4-5-11-17-28(37)21-22-31-32(34(41)24-33(31)40)23-29(38)18-14-15-20-36(43)45-26-30(39)25-44-35(42)19-13-10-8-6-7-9-12-16-27(2)3/h21-22,27-28,30-34,37,39-41H,4-20,23-26H2,1-3H3/b22-21+/t28-,30-,31+,32+,33+,34-/m0/s1 |
| InChIKey | RRXWJNOLOXXGCZ-MHODNDNJSA-N |
| XLogP | 5.98 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.90 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|