C38H62O6 — CID 157006790
[(2R)-2-hydroxy-3-(11-methyldodecanoyloxy)propyl] (4Z,7Z,10Z,13E,15E,19Z)-17-hydroxydocosa-4,7,10,13,15,19-hexaenoate (PubChem CID 157006790) has the molecular formula C38H62O6 and a molecular weight of 614.91 g/mol. Its IUPAC name is [(2R)-2-hydroxy-3-(11-methyldodecanoyloxy)propyl] (4Z,7Z,10Z,13E,15E,19Z)-17-hydroxydocosa-4,7,10,13,15,19-hexaenoate.
| Compound Name | [(2R)-2-hydroxy-3-(11-methyldodecanoyloxy)propyl] (4Z,7Z,10Z,13E,15E,19Z)-17-hydroxydocosa-4,7,10,13,15,19-hexaenoate |
|---|---|
| PubChem CID | 157006790 |
| Molecular Formula | C38H62O6 |
| Molecular Weight | 614.91 g/mol |
| Exact Mass | 614.45 |
| IUPAC Name | [(2R)-2-hydroxy-3-(11-methyldodecanoyloxy)propyl] (4Z,7Z,10Z,13E,15E,19Z)-17-hydroxydocosa-4,7,10,13,15,19-hexaenoate |
| SMILES | CC/C=C\CC(O)/C=C/C=C/C/C=C\C/C=C\C/C=C\CCC(=O)OC[C@H](O)COC(=O)CCCCCCCCCC(C)C |
| InChI | InChI=1S/C38H62O6/c1-4-5-22-28-35(39)29-24-19-15-11-9-7-6-8-10-12-16-20-25-30-37(41)43-32-36(40)33-44-38(42)31-26-21-17-13-14-18-23-27-34(2)3/h5,7-10,15-16,19-20,22,24,29,34-36,39-40H,4,6,11-14,17-18,21,23,25-28,30-33H2,1-3H3/b9-7-,10-8-,19-15+,20-16-,22-5-,29-24+/t35?,36-/m0/s1 |
| InChIKey | DJELYRZPNLRTLR-GBBKKVOTSA-N |
| XLogP | 9.05 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.91 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|