About 5-bromospiro[1,3-benzodioxole-2,1'-cyclohexane]
5-bromospiro[1,3-benzodioxole-2,1'-cyclohexane] (PubChem CID 15700682) has the molecular formula C12H13BrO2
and a molecular weight of 269.14 g/mol. Its IUPAC name is 5-bromospiro[1,3-benzodioxole-2,1'-cyclohexane].
Molecular Properties
| Compound Name | 5-bromospiro[1,3-benzodioxole-2,1'-cyclohexane] |
| PubChem CID | 15700682 |
| Molecular Formula | C12H13BrO2 |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 5-bromospiro[1,3-benzodioxole-2,1'-cyclohexane] |
| SMILES | Brc1ccc2c(c1)OC1(CCCCC1)O2 |
| InChI | InChI=1S/C12H13BrO2/c13-9-4-5-10-11(8-9)15-12(14-10)6-2-1-3-7-12/h4-5,8H,1-3,6-7H2 |
| InChIKey | IHDBSVKJVTVJAM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromospiro[1,3-benzodioxole-2,1'-cyclohexane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromospiro[1,3-benzodioxole-2,1'-cyclohexane]?
The IUPAC name of 5-bromospiro[1,3-benzodioxole-2,1'-cyclohexane] (CID 15700682) is 5-bromospiro[1,3-benzodioxole-2,1'-cyclohexane].
What is the SMILES notation for 5-bromospiro[1,3-benzodioxole-2,1'-cyclohexane]?
The canonical SMILES for 5-bromospiro[1,3-benzodioxole-2,1'-cyclohexane] is Brc1ccc2c(c1)OC1(CCCCC1)O2.
What is the InChIKey of 5-bromospiro[1,3-benzodioxole-2,1'-cyclohexane]?
The InChIKey is IHDBSVKJVTVJAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrO2/c13-9-4-5-10-11(8-9)15-12(14-10)6-2-1-3-7-12/h4-5,8H,1-3,6-7H2.
What are the key properties of 5-bromospiro[1,3-benzodioxole-2,1'-cyclohexane]?
5-bromospiro[1,3-benzodioxole-2,1'-cyclohexane] has a molecular weight of 269.14 g/mol, XLogP of 3.88, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromospiro[1,3-benzodioxole-2,1'-cyclohexane] is sourced from PubChem (CID 15700682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).