C29H35O16+ — CID 157010088
2-[7-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-3-yl]oxy-6-methyloxane-3,4,5-triol (PubChem CID 157010088) has the molecular formula C29H35O16+ and a molecular weight of 639.58 g/mol. Its IUPAC name is 2-[7-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-3-yl]oxy-6-methyloxane-3,4,5-triol.
| Compound Name | 2-[7-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-3-yl]oxy-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 157010088 |
| Molecular Formula | C29H35O16+ |
| Molecular Weight | 639.58 g/mol |
| Exact Mass | 639.19 |
| IUPAC Name | 2-[7-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-3-yl]oxy-6-methyloxane-3,4,5-triol |
| SMILES | COc1cc(-c2[o+]c3cc(O)cc(OC4OC(CO)C(O)C(O)C4O)c3cc2OC2OC(C)C(O)C(O)C2O)cc(OC)c1O |
| InChI | InChI=1S/C29H34O16/c1-10-20(32)23(35)25(37)28(41-10)44-18-8-13-14(42-27(18)11-4-16(39-2)21(33)17(5-11)40-3)6-12(31)7-15(13)43-29-26(38)24(36)22(34)19(9-30)45-29/h4-8,10,19-20,22-26,28-30,32,34-38H,9H2,1-3H3,(H-,31,33)/p+1 |
| InChIKey | GNUHZLJAPZCZJW-UHFFFAOYSA-O |
| XLogP | -0.81 |
| TPSA | 248.75 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.58 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|