C31H22O9 — CID 15701023
dimethyl 6,9,17,24,27-pentaoxohexacyclo[12.12.1.03,12.05,10.016,25.018,23]heptacosa-3,5(10),7,11,16(25),18,20,22-octaene-1,14-dicarboxylate (PubChem CID 15701023) has the molecular formula C31H22O9 and a molecular weight of 538.51 g/mol. Its IUPAC name is dimethyl 6,9,17,24,27-pentaoxohexacyclo[12.12.1.03,12.05,10.016,25.018,23]heptacosa-3,5(10),7,11,16(25),18,20,22-octaene-1,14-dicarboxylate.
| Compound Name | dimethyl 6,9,17,24,27-pentaoxohexacyclo[12.12.1.03,12.05,10.016,25.018,23]heptacosa-3,5(10),7,11,16(25),18,20,22-octaene-1,14-dicarboxylate |
|---|---|
| PubChem CID | 15701023 |
| Molecular Formula | C31H22O9 |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | dimethyl 6,9,17,24,27-pentaoxohexacyclo[12.12.1.03,12.05,10.016,25.018,23]heptacosa-3,5(10),7,11,16(25),18,20,22-octaene-1,14-dicarboxylate |
| SMILES | COC(=O)C12CC3=C(CC(C(=O)OC)(Cc4cc5c(cc4C1)C(=O)C=CC5=O)C2=O)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C31H22O9/c1-39-28(37)30-11-15-9-19-20(24(33)8-7-23(19)32)10-16(15)12-31(27(30)36,29(38)40-2)14-22-21(13-30)25(34)17-5-3-4-6-18(17)26(22)35/h3-10H,11-14H2,1-2H3 |
| InChIKey | KRIYNYXDVJUXEF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 137.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|