C27H20O3 — CID 15701025
hexacyclo[12.12.1.03,12.05,10.016,25.018,23]heptacosa-3(12),5,7,9,16,18,20,22,24-nonaene-4,11,27-trione (PubChem CID 15701025) has the molecular formula C27H20O3 and a molecular weight of 392.45 g/mol. Its IUPAC name is hexacyclo[12.12.1.03,12.05,10.016,25.018,23]heptacosa-3(12),5,7,9,16,18,20,22,24-nonaene-4,11,27-trione.
| Compound Name | hexacyclo[12.12.1.03,12.05,10.016,25.018,23]heptacosa-3(12),5,7,9,16,18,20,22,24-nonaene-4,11,27-trione |
|---|---|
| PubChem CID | 15701025 |
| Molecular Formula | C27H20O3 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | hexacyclo[12.12.1.03,12.05,10.016,25.018,23]heptacosa-3(12),5,7,9,16,18,20,22,24-nonaene-4,11,27-trione |
| SMILES | O=C1C2=C(CC3Cc4cc5ccccc5cc4CC(C2)C3=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C27H20O3/c28-25-19-11-17-9-15-5-1-2-6-16(15)10-18(17)12-20(25)14-24-23(13-19)26(29)21-7-3-4-8-22(21)27(24)30/h1-10,19-20H,11-14H2 |
| InChIKey | QHEPWXNPQUENGQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|