About (2-oxo-1,3-dihydroindol-3-yl) hydrogen sulfate
(2-oxo-1,3-dihydroindol-3-yl) hydrogen sulfate (PubChem CID 157010389) has the molecular formula C8H7NO5S
and a molecular weight of 229.21 g/mol. Its IUPAC name is (2-oxo-1,3-dihydroindol-3-yl) hydrogen sulfate.
Molecular Properties
| Compound Name | (2-oxo-1,3-dihydroindol-3-yl) hydrogen sulfate |
| PubChem CID | 157010389 |
| Molecular Formula | C8H7NO5S |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.00 |
| IUPAC Name | (2-oxo-1,3-dihydroindol-3-yl) hydrogen sulfate |
| SMILES | O=C1Nc2ccccc2C1OS(=O)(=O)O |
| InChI | InChI=1S/C8H7NO5S/c10-8-7(14-15(11,12)13)5-3-1-2-4-6(5)9-8/h1-4,7H,(H,9,10)(H,11,12,13) |
| InChIKey | HLYCAHONCGGOOJ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (2-oxo-1,3-dihydroindol-3-yl) hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-1,3-dihydroindol-3-yl) hydrogen sulfate?
The IUPAC name of (2-oxo-1,3-dihydroindol-3-yl) hydrogen sulfate (CID 157010389) is (2-oxo-1,3-dihydroindol-3-yl) hydrogen sulfate.
What is the SMILES notation for (2-oxo-1,3-dihydroindol-3-yl) hydrogen sulfate?
The canonical SMILES for (2-oxo-1,3-dihydroindol-3-yl) hydrogen sulfate is O=C1Nc2ccccc2C1OS(=O)(=O)O.
What is the InChIKey of (2-oxo-1,3-dihydroindol-3-yl) hydrogen sulfate?
The InChIKey is HLYCAHONCGGOOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO5S/c10-8-7(14-15(11,12)13)5-3-1-2-4-6(5)9-8/h1-4,7H,(H,9,10)(H,11,12,13).
What are the key properties of (2-oxo-1,3-dihydroindol-3-yl) hydrogen sulfate?
(2-oxo-1,3-dihydroindol-3-yl) hydrogen sulfate has a molecular weight of 229.21 g/mol, XLogP of 0.50, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-1,3-dihydroindol-3-yl) hydrogen sulfate is sourced from PubChem (CID 157010389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).