C16H16F6N6 — CID 157010573
1-N,4-N-bis[2-(trifluoromethyl)pyrimidin-4-yl]cyclohexane-1,4-diamine (PubChem CID 157010573) has the molecular formula C16H16F6N6 and a molecular weight of 406.33 g/mol. Its IUPAC name is 1-N,4-N-bis[2-(trifluoromethyl)pyrimidin-4-yl]cyclohexane-1,4-diamine.
| Compound Name | 1-N,4-N-bis[2-(trifluoromethyl)pyrimidin-4-yl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 157010573 |
| Molecular Formula | C16H16F6N6 |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 1-N,4-N-bis[2-(trifluoromethyl)pyrimidin-4-yl]cyclohexane-1,4-diamine |
| SMILES | FC(F)(F)c1nccc(NC2CCC(Nc3ccnc(C(F)(F)F)n3)CC2)n1 |
| InChI | InChI=1S/C16H16F6N6/c17-15(18,19)13-23-7-5-11(27-13)25-9-1-2-10(4-3-9)26-12-6-8-24-14(28-12)16(20,21)22/h5-10H,1-4H2,(H,23,25,27)(H,24,26,28) |
| InChIKey | AWHJAHLJFNFTGF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |