(2R,3R,4R,5R,6R)-5-amino-3,4,6-trihydroxyoxane-2-carboxylic acid

C6H11NO6 — CID 157010738

IUPAC(2R,3R,4R,5R,6R)-5-amino-3,4,6-trihydroxyoxane-2-carboxylic acid
SMILESN[C@@H]1[C@@H](O)[C@@H](O)[C@H](C(=O)O)O[C@H]1O
InChIInChI=1S/C6H11NO6/c7-1-2(8)3(9)4(5(10)11)13-6(1)12/h1-4,6,8-9,12H,7H2,(H,10,11)/t1-,2-,3-,4-,6-/m1/s1
InChIKeyCRIPFXSBMSGPKB-YBSDWZGDSA-N
MW193.16 g/mol
LogP-3.16
Rot. Bonds1

About (2R,3R,4R,5R,6R)-5-amino-3,4,6-trihydroxyoxane-2-carboxylic acid

(2R,3R,4R,5R,6R)-5-amino-3,4,6-trihydroxyoxane-2-carboxylic acid (PubChem CID 157010738) has the molecular formula C6H11NO6 and a molecular weight of 193.16 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-5-amino-3,4,6-trihydroxyoxane-2-carboxylic acid.

Molecular Properties

Compound Name(2R,3R,4R,5R,6R)-5-amino-3,4,6-trihydroxyoxane-2-carboxylic acid
PubChem CID157010738
Molecular FormulaC6H11NO6
Molecular Weight193.16 g/mol
Exact Mass193.06
IUPAC Name(2R,3R,4R,5R,6R)-5-amino-3,4,6-trihydroxyoxane-2-carboxylic acid
SMILESN[C@@H]1[C@@H](O)[C@@H](O)[C@H](C(=O)O)O[C@H]1O
InChIInChI=1S/C6H11NO6/c7-1-2(8)3(9)4(5(10)11)13-6(1)12/h1-4,6,8-9,12H,7H2,(H,10,11)/t1-,2-,3-,4-,6-/m1/s1
InChIKeyCRIPFXSBMSGPKB-YBSDWZGDSA-N
XLogP-3.16
TPSA133.24 Ų
H-Bond Donors5
H-Bond Acceptors6
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.16
LogP ≤ 5-3.16
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 106

Analyze (2R,3R,4R,5R,6R)-5-amino-3,4,6-trihydroxyoxane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

beta-Neuraminic acid
CID 513472
Muramic acid
CID 441038
9-O-acetylneuraminic acid
CID 440038
Chondrosine
CID 71586761
GlyTouCan:G80488QF
CID 22833605
(S)-malyl alpha-D-glucosaminide
CID 57339274
beta-Muramic acid
CID 446972
2-(3-Amino-2,5-dihydroxy-6-hydroxymethyl-tetrahydro-pyran-4-yloxy)-propionic acid
CID 433580
Neuraminic acid
CID 441037
(S)-malyl alpha-D-glucosaminide(1-)
CID 57339292
2-acetamido-2-deoxy-D-galacturonic acid
CID 54011344
alpha-Neuraminic acid
CID 11219339

Frequently Asked Questions

What is the IUPAC name of (2R,3R,4R,5R,6R)-5-amino-3,4,6-trihydroxyoxane-2-carboxylic acid?
The IUPAC name of (2R,3R,4R,5R,6R)-5-amino-3,4,6-trihydroxyoxane-2-carboxylic acid (CID 157010738) is (2R,3R,4R,5R,6R)-5-amino-3,4,6-trihydroxyoxane-2-carboxylic acid.
What is the SMILES notation for (2R,3R,4R,5R,6R)-5-amino-3,4,6-trihydroxyoxane-2-carboxylic acid?
The canonical SMILES for (2R,3R,4R,5R,6R)-5-amino-3,4,6-trihydroxyoxane-2-carboxylic acid is N[C@@H]1[C@@H](O)[C@@H](O)[C@H](C(=O)O)O[C@H]1O.
What is the InChIKey of (2R,3R,4R,5R,6R)-5-amino-3,4,6-trihydroxyoxane-2-carboxylic acid?
The InChIKey is CRIPFXSBMSGPKB-YBSDWZGDSA-N. The full InChI is InChI=1S/C6H11NO6/c7-1-2(8)3(9)4(5(10)11)13-6(1)12/h1-4,6,8-9,12H,7H2,(H,10,11)/t1-,2-,3-,4-,6-/m1/s1.
What are the key properties of (2R,3R,4R,5R,6R)-5-amino-3,4,6-trihydroxyoxane-2-carboxylic acid?
(2R,3R,4R,5R,6R)-5-amino-3,4,6-trihydroxyoxane-2-carboxylic acid has a molecular weight of 193.16 g/mol, XLogP of -3.16, 1 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R,4R,5R,6R)-5-amino-3,4,6-trihydroxyoxane-2-carboxylic acid is sourced from PubChem (CID 157010738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).