About 1-[4-(4,5-dimethylpyridazin-3-yl)phenyl]-N,N-dimethylmethanamine
1-[4-(4,5-dimethylpyridazin-3-yl)phenyl]-N,N-dimethylmethanamine (PubChem CID 157011002) has the molecular formula C15H19N3
and a molecular weight of 241.34 g/mol. Its IUPAC name is 1-[4-(4,5-dimethylpyridazin-3-yl)phenyl]-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-[4-(4,5-dimethylpyridazin-3-yl)phenyl]-N,N-dimethylmethanamine |
| PubChem CID | 157011002 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 1-[4-(4,5-dimethylpyridazin-3-yl)phenyl]-N,N-dimethylmethanamine |
| SMILES | Cc1cnnc(-c2ccc(CN(C)C)cc2)c1C |
| InChI | InChI=1S/C15H19N3/c1-11-9-16-17-15(12(11)2)14-7-5-13(6-8-14)10-18(3)4/h5-9H,10H2,1-4H3 |
| InChIKey | ZZNCEBXGYYFEPP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-(4,5-dimethylpyridazin-3-yl)phenyl]-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4,5-dimethylpyridazin-3-yl)phenyl]-N,N-dimethylmethanamine?
The IUPAC name of 1-[4-(4,5-dimethylpyridazin-3-yl)phenyl]-N,N-dimethylmethanamine (CID 157011002) is 1-[4-(4,5-dimethylpyridazin-3-yl)phenyl]-N,N-dimethylmethanamine.
What is the SMILES notation for 1-[4-(4,5-dimethylpyridazin-3-yl)phenyl]-N,N-dimethylmethanamine?
The canonical SMILES for 1-[4-(4,5-dimethylpyridazin-3-yl)phenyl]-N,N-dimethylmethanamine is Cc1cnnc(-c2ccc(CN(C)C)cc2)c1C.
What is the InChIKey of 1-[4-(4,5-dimethylpyridazin-3-yl)phenyl]-N,N-dimethylmethanamine?
The InChIKey is ZZNCEBXGYYFEPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3/c1-11-9-16-17-15(12(11)2)14-7-5-13(6-8-14)10-18(3)4/h5-9H,10H2,1-4H3.
What are the key properties of 1-[4-(4,5-dimethylpyridazin-3-yl)phenyl]-N,N-dimethylmethanamine?
1-[4-(4,5-dimethylpyridazin-3-yl)phenyl]-N,N-dimethylmethanamine has a molecular weight of 241.34 g/mol, XLogP of 2.82, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4,5-dimethylpyridazin-3-yl)phenyl]-N,N-dimethylmethanamine is sourced from PubChem (CID 157011002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).