C32H21Br3O5 — CID 15701118
(2S,10'S)-3',7,8'-tribromo-10'-hydroxy-10'-(2-oxobutyl)spiro[1H-benzo[e][1]benzofuran-2,11'-benzo[a]xanthene]-9'-one (PubChem CID 15701118) has the molecular formula C32H21Br3O5 and a molecular weight of 725.23 g/mol. Its IUPAC name is (2S,10'S)-3',7,8'-tribromo-10'-hydroxy-10'-(2-oxobutyl)spiro[1H-benzo[e][1]benzofuran-2,11'-benzo[a]xanthene]-9'-one.
| Compound Name | (2S,10'S)-3',7,8'-tribromo-10'-hydroxy-10'-(2-oxobutyl)spiro[1H-benzo[e][1]benzofuran-2,11'-benzo[a]xanthene]-9'-one |
|---|---|
| PubChem CID | 15701118 |
| Molecular Formula | C32H21Br3O5 |
| Molecular Weight | 725.23 g/mol |
| Exact Mass | 721.89 |
| IUPAC Name | (2S,10'S)-3',7,8'-tribromo-10'-hydroxy-10'-(2-oxobutyl)spiro[1H-benzo[e][1]benzofuran-2,11'-benzo[a]xanthene]-9'-one |
| SMILES | CCC(=O)C[C@@]1(O)C(=O)C(Br)=C2Oc3ccc4cc(Br)ccc4c3C=C2[C@@]12Cc1c(ccc3cc(Br)ccc13)O2 |
| InChI | InChI=1S/C32H21Br3O5/c1-2-20(36)14-31(38)30(37)28(35)29-25(13-23-21-7-5-18(33)11-16(21)3-9-26(23)39-29)32(31)15-24-22-8-6-19(34)12-17(22)4-10-27(24)40-32/h3-13,38H,2,14-15H2,1H3/t31-,32+/m1/s1 |
| InChIKey | IOXXUDAXTQTZLP-ZWXJPIIXSA-N |
| XLogP | 7.96 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.23 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|