About N-(3,4-diethyl-1,2-oxazol-5-yl)-2-(2H-indazol-3-yl)acetamide
N-(3,4-diethyl-1,2-oxazol-5-yl)-2-(2H-indazol-3-yl)acetamide (PubChem CID 157011878) has the molecular formula C16H18N4O2
and a molecular weight of 298.35 g/mol. Its IUPAC name is N-(3,4-diethyl-1,2-oxazol-5-yl)-2-(2H-indazol-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(3,4-diethyl-1,2-oxazol-5-yl)-2-(2H-indazol-3-yl)acetamide |
| PubChem CID | 157011878 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-(3,4-diethyl-1,2-oxazol-5-yl)-2-(2H-indazol-3-yl)acetamide |
| SMILES | CCc1noc(NC(=O)Cc2[nH]nc3ccccc23)c1CC |
| InChI | InChI=1S/C16H18N4O2/c1-3-10-12(4-2)20-22-16(10)17-15(21)9-14-11-7-5-6-8-13(11)18-19-14/h5-8H,3-4,9H2,1-2H3,(H,17,21)(H,18,19) |
| InChIKey | ANWBUTDZFMYDCV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3,4-diethyl-1,2-oxazol-5-yl)-2-(2H-indazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-diethyl-1,2-oxazol-5-yl)-2-(2H-indazol-3-yl)acetamide?
The IUPAC name of N-(3,4-diethyl-1,2-oxazol-5-yl)-2-(2H-indazol-3-yl)acetamide (CID 157011878) is N-(3,4-diethyl-1,2-oxazol-5-yl)-2-(2H-indazol-3-yl)acetamide.
What is the SMILES notation for N-(3,4-diethyl-1,2-oxazol-5-yl)-2-(2H-indazol-3-yl)acetamide?
The canonical SMILES for N-(3,4-diethyl-1,2-oxazol-5-yl)-2-(2H-indazol-3-yl)acetamide is CCc1noc(NC(=O)Cc2[nH]nc3ccccc23)c1CC.
What is the InChIKey of N-(3,4-diethyl-1,2-oxazol-5-yl)-2-(2H-indazol-3-yl)acetamide?
The InChIKey is ANWBUTDZFMYDCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4O2/c1-3-10-12(4-2)20-22-16(10)17-15(21)9-14-11-7-5-6-8-13(11)18-19-14/h5-8H,3-4,9H2,1-2H3,(H,17,21)(H,18,19).
What are the key properties of N-(3,4-diethyl-1,2-oxazol-5-yl)-2-(2H-indazol-3-yl)acetamide?
N-(3,4-diethyl-1,2-oxazol-5-yl)-2-(2H-indazol-3-yl)acetamide has a molecular weight of 298.35 g/mol, XLogP of 2.86, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-diethyl-1,2-oxazol-5-yl)-2-(2H-indazol-3-yl)acetamide is sourced from PubChem (CID 157011878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).