C18H28N4O — CID 157012049
(3aR,6aS)-5-[methyl-(6-piperidin-1-ylpyrimidin-4-yl)amino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol (PubChem CID 157012049) has the molecular formula C18H28N4O and a molecular weight of 316.45 g/mol. Its IUPAC name is (3aR,6aS)-5-[methyl-(6-piperidin-1-ylpyrimidin-4-yl)amino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol.
| Compound Name | (3aR,6aS)-5-[methyl-(6-piperidin-1-ylpyrimidin-4-yl)amino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
|---|---|
| PubChem CID | 157012049 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | (3aR,6aS)-5-[methyl-(6-piperidin-1-ylpyrimidin-4-yl)amino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
| SMILES | CN(c1cc(N2CCCCC2)ncn1)C1C[C@H]2CC(O)C[C@H]2C1 |
| InChI | InChI=1S/C18H28N4O/c1-21(15-7-13-9-16(23)10-14(13)8-15)17-11-18(20-12-19-17)22-5-3-2-4-6-22/h11-16,23H,2-10H2,1H3/t13-,14+,15?,16? |
| InChIKey | YKUVEVSJGASMJJ-PJPHBNEVSA-N |
| XLogP | 2.45 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |