C29H36N4O7 — CID 157012298
(7S,9S,13R,16S)-9-hydroxy-21-(2-methoxyphenyl)-13-methyl-16-propan-2-yl-2-oxa-5,11,14,17-tetrazatricyclo[17.4.0.07,11]tricosa-1(19),20,22-triene-6,12,15,18-tetrone (PubChem CID 157012298) has the molecular formula C29H36N4O7 and a molecular weight of 552.63 g/mol. Its IUPAC name is (7S,9S,13R,16S)-9-hydroxy-21-(2-methoxyphenyl)-13-methyl-16-propan-2-yl-2-oxa-5,11,14,17-tetrazatricyclo[17.4.0.07,11]tricosa-1(19),20,22-triene-6,12,15,18-tetrone.
| Compound Name | (7S,9S,13R,16S)-9-hydroxy-21-(2-methoxyphenyl)-13-methyl-16-propan-2-yl-2-oxa-5,11,14,17-tetrazatricyclo[17.4.0.07,11]tricosa-1(19),20,22-triene-6,12,15,18-tetrone |
|---|---|
| PubChem CID | 157012298 |
| Molecular Formula | C29H36N4O7 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | (7S,9S,13R,16S)-9-hydroxy-21-(2-methoxyphenyl)-13-methyl-16-propan-2-yl-2-oxa-5,11,14,17-tetrazatricyclo[17.4.0.07,11]tricosa-1(19),20,22-triene-6,12,15,18-tetrone |
| SMILES | COc1ccccc1-c1ccc2c(c1)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](C)C(=O)N1C[C@@H](O)C[C@H]1C(=O)NCCO2 |
| InChI | InChI=1S/C29H36N4O7/c1-16(2)25-28(37)31-17(3)29(38)33-15-19(34)14-22(33)27(36)30-11-12-40-24-10-9-18(13-21(24)26(35)32-25)20-7-5-6-8-23(20)39-4/h5-10,13,16-17,19,22,25,34H,11-12,14-15H2,1-4H3,(H,30,36)(H,31,37)(H,32,35)/t17-,19+,22+,25+/m1/s1 |
| InChIKey | ZNDPDQNZZJTRCZ-NHGJLWFOSA-N |
| XLogP | 1.09 |
| TPSA | 146.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |