C16H21N5S — CID 157012379
N-[3-(2-ethylimidazol-1-yl)propyl]-4,6-dimethyl-[1,2]thiazolo[5,4-b]pyridin-3-amine (PubChem CID 157012379) has the molecular formula C16H21N5S and a molecular weight of 315.45 g/mol. Its IUPAC name is N-[3-(2-ethylimidazol-1-yl)propyl]-4,6-dimethyl-[1,2]thiazolo[5,4-b]pyridin-3-amine.
| Compound Name | N-[3-(2-ethylimidazol-1-yl)propyl]-4,6-dimethyl-[1,2]thiazolo[5,4-b]pyridin-3-amine |
|---|---|
| PubChem CID | 157012379 |
| Molecular Formula | C16H21N5S |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | N-[3-(2-ethylimidazol-1-yl)propyl]-4,6-dimethyl-[1,2]thiazolo[5,4-b]pyridin-3-amine |
| SMILES | CCc1nccn1CCCNc1nsc2nc(C)cc(C)c12 |
| InChI | InChI=1S/C16H21N5S/c1-4-13-17-7-9-21(13)8-5-6-18-15-14-11(2)10-12(3)19-16(14)22-20-15/h7,9-10H,4-6,8H2,1-3H3,(H,18,20) |
| InChIKey | ZMYINMASGXIJPU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|