C12H20N4OS — CID 157012448
(2R)-2-amino-3-methyl-N-[(5-methylpyrazin-2-yl)methyl]-3-methylsulfanylbutanamide (PubChem CID 157012448) has the molecular formula C12H20N4OS and a molecular weight of 268.39 g/mol. Its IUPAC name is (2R)-2-amino-3-methyl-N-[(5-methylpyrazin-2-yl)methyl]-3-methylsulfanylbutanamide.
| Compound Name | (2R)-2-amino-3-methyl-N-[(5-methylpyrazin-2-yl)methyl]-3-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 157012448 |
| Molecular Formula | C12H20N4OS |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | (2R)-2-amino-3-methyl-N-[(5-methylpyrazin-2-yl)methyl]-3-methylsulfanylbutanamide |
| SMILES | CSC(C)(C)[C@H](N)C(=O)NCc1cnc(C)cn1 |
| InChI | InChI=1S/C12H20N4OS/c1-8-5-15-9(6-14-8)7-16-11(17)10(13)12(2,3)18-4/h5-6,10H,7,13H2,1-4H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | FKKFDOYHINMBHC-SNVBAGLBSA-N |
| XLogP | 0.87 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |