C22H32N6O2 — CID 157013501
4-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-12-phenyl-1,4,8-triazacyclotetradecane-2,9-dione (PubChem CID 157013501) has the molecular formula C22H32N6O2 and a molecular weight of 412.54 g/mol. Its IUPAC name is 4-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-12-phenyl-1,4,8-triazacyclotetradecane-2,9-dione.
| Compound Name | 4-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-12-phenyl-1,4,8-triazacyclotetradecane-2,9-dione |
|---|---|
| PubChem CID | 157013501 |
| Molecular Formula | C22H32N6O2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 4-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-12-phenyl-1,4,8-triazacyclotetradecane-2,9-dione |
| SMILES | CCn1cnnc1CN1CCCNC(=O)CCC(c2ccccc2)CCNC(=O)C1 |
| InChI | InChI=1S/C22H32N6O2/c1-2-28-17-25-26-20(28)15-27-14-6-12-23-21(29)10-9-19(11-13-24-22(30)16-27)18-7-4-3-5-8-18/h3-5,7-8,17,19H,2,6,9-16H2,1H3,(H,23,29)(H,24,30) |
| InChIKey | GTLQVCIWXMOZCU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |