C17H24N4OS — CID 157013867
(2R)-2-amino-3-methyl-3-methylsulfanyl-N-[2-(1-phenylpyrazol-4-yl)ethyl]butanamide (PubChem CID 157013867) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is (2R)-2-amino-3-methyl-3-methylsulfanyl-N-[2-(1-phenylpyrazol-4-yl)ethyl]butanamide.
| Compound Name | (2R)-2-amino-3-methyl-3-methylsulfanyl-N-[2-(1-phenylpyrazol-4-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 157013867 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | (2R)-2-amino-3-methyl-3-methylsulfanyl-N-[2-(1-phenylpyrazol-4-yl)ethyl]butanamide |
| SMILES | CSC(C)(C)[C@H](N)C(=O)NCCc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C17H24N4OS/c1-17(2,23-3)15(18)16(22)19-10-9-13-11-20-21(12-13)14-7-5-4-6-8-14/h4-8,11-12,15H,9-10,18H2,1-3H3,(H,19,22)/t15-/m1/s1 |
| InChIKey | MYRKPENJGQYAKE-OAHLLOKOSA-N |
| XLogP | 2.00 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |