C17H26N4O6 — CID 157014637
(4aR,6S,8aR)-4-(3-hydroxypropanoyl)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-6-carboxamide (PubChem CID 157014637) has the molecular formula C17H26N4O6 and a molecular weight of 382.42 g/mol. Its IUPAC name is (4aR,6S,8aR)-4-(3-hydroxypropanoyl)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-6-carboxamide.
| Compound Name | (4aR,6S,8aR)-4-(3-hydroxypropanoyl)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-6-carboxamide |
|---|---|
| PubChem CID | 157014637 |
| Molecular Formula | C17H26N4O6 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | (4aR,6S,8aR)-4-(3-hydroxypropanoyl)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-6-carboxamide |
| SMILES | Cc1nonc1OCCNC(=O)[C@H]1CC[C@H]2OCCN(C(=O)CCO)[C@@H]2C1 |
| InChI | InChI=1S/C17H26N4O6/c1-11-17(20-27-19-11)26-8-5-18-16(24)12-2-3-14-13(10-12)21(6-9-25-14)15(23)4-7-22/h12-14,22H,2-10H2,1H3,(H,18,24)/t12-,13+,14+/m0/s1 |
| InChIKey | OOLDEWATUPVYOY-BFHYXJOUSA-N |
| XLogP | -0.35 |
| TPSA | 127.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|