C13H15N7 — CID 157015505
9-methyl-N-(4,5,6,7-tetrahydro-1H-indazol-6-yl)purin-2-amine (PubChem CID 157015505) has the molecular formula C13H15N7 and a molecular weight of 269.31 g/mol. Its IUPAC name is 9-methyl-N-(4,5,6,7-tetrahydro-1H-indazol-6-yl)purin-2-amine.
| Compound Name | 9-methyl-N-(4,5,6,7-tetrahydro-1H-indazol-6-yl)purin-2-amine |
|---|---|
| PubChem CID | 157015505 |
| Molecular Formula | C13H15N7 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 9-methyl-N-(4,5,6,7-tetrahydro-1H-indazol-6-yl)purin-2-amine |
| SMILES | Cn1cnc2cnc(NC3CCc4cn[nH]c4C3)nc21 |
| InChI | InChI=1S/C13H15N7/c1-20-7-15-11-6-14-13(18-12(11)20)17-9-3-2-8-5-16-19-10(8)4-9/h5-7,9H,2-4H2,1H3,(H,16,19)(H,14,17,18) |
| InChIKey | HRWKQXCLVJONMU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |