About 4-(6-methoxy-1,3-benzodioxol-5-yl)-7-methylthieno[3,2-d]pyrimidine
4-(6-methoxy-1,3-benzodioxol-5-yl)-7-methylthieno[3,2-d]pyrimidine (PubChem CID 157016098) has the molecular formula C15H12N2O3S
and a molecular weight of 300.34 g/mol. Its IUPAC name is 4-(6-methoxy-1,3-benzodioxol-5-yl)-7-methylthieno[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 4-(6-methoxy-1,3-benzodioxol-5-yl)-7-methylthieno[3,2-d]pyrimidine |
| PubChem CID | 157016098 |
| Molecular Formula | C15H12N2O3S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 4-(6-methoxy-1,3-benzodioxol-5-yl)-7-methylthieno[3,2-d]pyrimidine |
| SMILES | COc1cc2c(cc1-c1ncnc3c(C)csc13)OCO2 |
| InChI | InChI=1S/C15H12N2O3S/c1-8-5-21-15-13(8)16-6-17-14(15)9-3-11-12(20-7-19-11)4-10(9)18-2/h3-6H,7H2,1-2H3 |
| InChIKey | ZZQBXGUEVBWHPC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(6-methoxy-1,3-benzodioxol-5-yl)-7-methylthieno[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-methoxy-1,3-benzodioxol-5-yl)-7-methylthieno[3,2-d]pyrimidine?
The IUPAC name of 4-(6-methoxy-1,3-benzodioxol-5-yl)-7-methylthieno[3,2-d]pyrimidine (CID 157016098) is 4-(6-methoxy-1,3-benzodioxol-5-yl)-7-methylthieno[3,2-d]pyrimidine.
What is the SMILES notation for 4-(6-methoxy-1,3-benzodioxol-5-yl)-7-methylthieno[3,2-d]pyrimidine?
The canonical SMILES for 4-(6-methoxy-1,3-benzodioxol-5-yl)-7-methylthieno[3,2-d]pyrimidine is COc1cc2c(cc1-c1ncnc3c(C)csc13)OCO2.
What is the InChIKey of 4-(6-methoxy-1,3-benzodioxol-5-yl)-7-methylthieno[3,2-d]pyrimidine?
The InChIKey is ZZQBXGUEVBWHPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O3S/c1-8-5-21-15-13(8)16-6-17-14(15)9-3-11-12(20-7-19-11)4-10(9)18-2/h3-6H,7H2,1-2H3.
What are the key properties of 4-(6-methoxy-1,3-benzodioxol-5-yl)-7-methylthieno[3,2-d]pyrimidine?
4-(6-methoxy-1,3-benzodioxol-5-yl)-7-methylthieno[3,2-d]pyrimidine has a molecular weight of 300.34 g/mol, XLogP of 3.40, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-methoxy-1,3-benzodioxol-5-yl)-7-methylthieno[3,2-d]pyrimidine is sourced from PubChem (CID 157016098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).