C23H29N3O2 — CID 157016143
2-(cyclopropylamino)-1-[4-(2-phenoxy-1-phenylethyl)piperazin-1-yl]ethanone (PubChem CID 157016143) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 2-(cyclopropylamino)-1-[4-(2-phenoxy-1-phenylethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(cyclopropylamino)-1-[4-(2-phenoxy-1-phenylethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 157016143 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 2-(cyclopropylamino)-1-[4-(2-phenoxy-1-phenylethyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CNC1CC1)N1CCN(C(COc2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H29N3O2/c27-23(17-24-20-11-12-20)26-15-13-25(14-16-26)22(19-7-3-1-4-8-19)18-28-21-9-5-2-6-10-21/h1-10,20,22,24H,11-18H2 |
| InChIKey | QRWVQVOWIRWKGA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |