C21H24N4O2 — CID 157016211
[3-(1-hydroxy-2-methylpropyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)methanone (PubChem CID 157016211) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is [3-(1-hydroxy-2-methylpropyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)methanone.
| Compound Name | [3-(1-hydroxy-2-methylpropyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)methanone |
|---|---|
| PubChem CID | 157016211 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | [3-(1-hydroxy-2-methylpropyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)methanone |
| SMILES | CC(C)C(O)c1nnc2ccc(C(=O)N3CCCc4ccccc4C3)cn12 |
| InChI | InChI=1S/C21H24N4O2/c1-14(2)19(26)20-23-22-18-10-9-17(13-25(18)20)21(27)24-11-5-8-15-6-3-4-7-16(15)12-24/h3-4,6-7,9-10,13-14,19,26H,5,8,11-12H2,1-2H3 |
| InChIKey | NODPPVXKHZQAJQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 70.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |